Gas (G) and particle (P) species from the namelists. SMILES link to representative structures in the EPA Chemicals Dashboard (if available).

Note that for each particulate species in CMAQ, a letter will be appended to the name to designate the size, or mode, of the aerosol being represented: I = Aitken mode, J = Accumulation mode, K = Coarse mode. Prepending of a species with a V or A in CMAQ or the chemical mechanism files indicates the species resides in the gas or particulate phase.

Species	Description	Phase	Molecular Weight (g/mol)	Explicit/ Lumped	Representative Structure	SMILES
AAL	Aluminum ion	P	27.0	E	Aluminum ion	[Al+3]
ACA	Calcium ion	P	40.1	E	Calcium ion	[Ca++]
ACD	Acetaldehyde	G	44.0	E	Acetaldehyde	CC=O
ACE	Acetylene	G	26.0	E	Acetylene	C#C
ACL	Chloride ion	P	35.5	E	Chloride ion	[Cl-]
ACO3	Acetyl peroxy radicals	G	75.0	E	Acetylperoxy	CC(=O)O[O]
ACORS	Primary unspeciated coarse PM	P	100.0	L	Coarse PM
ACRO	Acrolein	G	56.1	E	Acrolein	C=CC=O
ACT	Acetone	G	58.0	E	Acetone	CC(C)=O
ACTP	Peroxy radicals formed from ACT	G	89.0	E	(2-oxopropyl)peroxy	CC(=O)CO[O]
ADCN	Aromatic-NO3 adduct from PHEN	G	155.0	L	4-oxocyclohex-2-en-1-yl nitrate	OC1=C[C]C(O[N+]([O-])=O)C=C1
ADDC	Aromatic-HO adduct from CSL	G	125.0	L	3-methyl-5-oxocyclohex-3-en-1-yloxidanyl	CC1=CC(O)=CC([O])C1
AEC	Elemental carbon	P	12.0	L	Carbon	[C]
AFE	Iron ion	P	55.8	E	Iron ion	[Fe++]
AGLY	SOA from reactive uptake of glyoxal on particles	P	66.4	L	2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol	OC2OC(C1OC(O)C(O)O1)OC2O
AH2O	Water associated with particulate inorganic compounds	P	18.0	E	Water	O
AH3OP	Hydronium ion tracer	P	19.0	E	Hydronium ion	[OH3+]
AISO3NOS	Non-sulfated SOA from IEPOX uptake	P	136.2	L	2-methylbutane-1,2,3,4-tetrol	C(O)C(O)(C)C(O)CO
AISO3OS	Organosulfate SOA from IEPOX uptake	P	216.2	L	(1,3,4-trihydroxy-2-methylbutan-2-yl)oxysulfonic acid	C(O)C(OS(O)(=O)(=O))(C)C(O)CO
AK	Potassium ion	P	39.1	E	Potassium ion	[K+]
ALD	C3 and higher aldehydes	G	58.0	L	Propanal	CCC=O
AMG	Magnesium ion	P	24.3	E	Magnesium ion	[Mg++]
AMN	Manganese ion	P	54.9	L	Manganese ions	[Mn++]
ANA	Sodium ion	P	23.0	E	Sodium ion	[Na+]
ANH4	Ammonium ion	P	18.0	E	Ammonium ion	[NH4+]
ANO3	Nitrate ion	P	62.0	E	Nitrate ion	[N+](=O)([O-])[O-]
AORGC	SOA from cloud processing of GLY and MGLY	P	177.0	L	2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol	OC2OC(C1OC(O)C(O)O1)OC2O
AORGH2O	Water associated with particulate organic compounds	P	18.0	E	Water	O
AOTHR	Primary unspeciated fine PM	P	200.0	L	Unspeciated PM
API	Alpha-pinenes and other cyclic terpenes with one double bond	G	136.4	L	alpha-pinene	CC1=CCC2CC1C2(C)C
APINP1	Peroxy radicals from API+NO3 that do not undergo autoxidation	G	230.0	L	[2,6,6-trimethyl-3-(nitrooxy)bicyclo[3.1.1]heptan-2-yl]peroxy	[O]OC1(C)C(ON(=O)=O)CC2CC1C2(C)C
APINP2	Peroxy radicals from API+NO3 that undergo autoxidation	G	230.0	L	[2,6,6-trimethyl-3-(nitrooxy)bicyclo[3.1.1]heptan-2-yl]peroxy	[O]OC1(C)C(ON(=O)=O)CC2CC1C2(C)C
APIP1	Peroxy radicals from API+OH that do not undergo autoxidation	G	185.0	L	{3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl}peroxy	[O]OC1(C)C(O)CC2CC1C2(C)C
APIP2	Peroxy radicals from API+OH that undergo autoxidation	G	185.0	L	{3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl}peroxy	[O]OC1(C)C(O)CC2CC1C2(C)C
APNCOM	Primary non-carbon organic matter (legacy)	P	220.0	L	Non-carbon organic matter
APOC	Primary organic carbon (legacy)	P	220.0	L	Organic carbon
ASEACAT	Sea spray cations	P	23.75	L	Coarse sea spray cations
ASI	Silicon	P	28.1	E	Total Silicon	[Si]
ASO4	Total sulfur IV as sulfate	P	96.0	L	Sulfate ion	[O-]S(=O)(=O)[O-]
ASOAT	An empirical SOA	P	200.0	L	3,4,5,6,7-Pentahydroxyheptan-2-one	CC(=O)C(C(C(C(CO)O)O)O)O
ASOIL	Lumped crustal species	P	100.0	L	Crustal species
ATI	Titanium	P	47.9	E	Total Titanium	[Ti]
BAL1	Peroxy radicals formed from BALD	G	123.0	L	(4-methylphenyl)peroxy	[O]OC1=CC=C(C)C=C1
BAL2	Peroxy radicals formed from BALD	G	109.0	L	phenylperoxy	[O]OC1=CC=CC=C1
BALD	Benzaldehyde and other aromatic aldehydes	G	106.0	L	Benzaldehyde	O=CC1=CC=CC=C1
BALP	Peroxy radicals formed from BALD	G	137.0	L	benzoylperoxy	O=C(O[O])C1=CC=CC=C1
BDE13	1,3-butadiene	G	54.1	E	1,3-Butadiene	C=CC=C
BDE13P	Peroxy radicals from BDE13	G	103.0	L	(1-hydroxybut-3-en-2-yl)peroxy	C=CC(O[O])CO
BEN	Benzene	G	78.11	E	Benzene	C1=CC=CC=C1
BENP	Peroxy radicals formed from benzene	G	159.12	L	{8-hydroxy-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2OOC1C2O
CHO	Phenoxy radical formed from CSL	G	139.0	L	4-hydroxy-3,5-dimethylcyclohexa-2,5-dien-1-yloxidanyl	[O]C1C=C(C)C(O)C(=C1)C
CO	Carbon monoxide	G	28.0	E	Carbon monoxide	[C-]#[O+]
CSL	Cresol and other hydroxy substituted aromatics	G	136.2	L	2-Phenylpropan-2-ol	CC(C)(O)C1=CC=CC=C1
DCB1	Unsaturated dicarbonyls	G	98.0	L	2-methylbut-2-enedial	O=CC=C(C)C=O
DCB2	Unsaturated dicarbonyls	G	112.1	L	2-methyl-4-oxopent-2-enal	O=CC(=CC(=O)C)C
DCB3	Unsaturated dicarbonyls	G	84.0	L	but-2-enedial	O=CC=CC=O
ELHOM	Extremely-low volatility highly oxygenated molecules from terpenes	GP	402.0	L	6-hydroperoxy-7-({3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl}peroxy)-3,3,6-trimethyl-tetrahydro-3aH-1,2-benzodioxol-5-ol	OC1CC2C(OOC2(C)C)C(OOC3(C)C4C(C)(C)C(C4)CC3O)C1(C)OO
EOH	Ethanol	G	46.1	E	Ethanol	CCO
ETE	ethene	G	28.1	E	Ethylene	C=C
ETEG	Ethylene glycol	G	62.1	E	Ethylene glycol	OCCO
ETEP	Peroxy radicals formed from ETE	G	77.0	E	(2-hydroxyethyl)peroxy	OCCO[O]
ETH	ethane	G	30.1	E	Ethane	CC
ETHP	Peroxy radicals formed from ethane and other species	G	61.0	L	Ethylperoxy	CCO[O]
FURAN	Furans and other dienes	G	96.1	L	Furfural	O=CC1=CC=CO1
FURANO2	Peroxy radicals from FURAN oxidation	G	145.1	L	(2-formyl-5-hydroxy-5H-furan-2-yl)peroxy	OC1C=CC(O1)(O[O])(C=O)
FURANONE	Ring-retaining ketone product from FURAN oxidation	G	100.1	L	2-hydroxy-2H-furan-5-one	C1=CC(=O)OC1O
GLY	Glyoxal and glycoaldehydes	G	58.0	L	Glyoxal	O=CC=O
H2O2	Hydrogen peroxide	G	34.0	E	Hydrogen peroxide	OO
HC10	Alkanes and other species with HO rate constant greater than 6.8x10-12 cm3 s-1	G	142.28	L	Decane	CCCCCCCCCC
HC10P	Peroxy radicals formed from HC10	G	173.27	L	Decan-3-ylperoxy	CCCCCCCC(CC)O[O]
HC10P2	Hydroxy peroxy radicals from HC10P alkoxy product	G	189.27	L	(8-hydroxydecan-5-yl)peroxy	CCCCC(O[O])CCC(O)CC
HC3	Alkanes and other species with HO rate constant less than 3.4x10-12 cm3 s-1	G	44.1	L	Propane	CCC
HC3P	Peroxy radicals formed from HC3	G	75.0	L	Isopropyl peroxy	CC(C)O[O]
HC5	Alkanes and other species with HO rate constant between 3.4x10-12 and 6.8x10-12 cm3 s-1	G	72.1	L	Pentane	CCCCC
HC5P	Peroxy radicals formed from HC5	G	103.0	L	Pentan-3-ylperoxy	CCC(O[O])CC
HCHO	Formaldehyde	G	30.0	E	Formaldehyde	C=O
HCL	Hydrochloric acid	G	36.0	E	Hydrochloric acid	Cl
HKET	Hydroxy ketone	G	74.0	L	Hydroxy acetone	CC(=O)CO
HNO3	Nitric acid	G	63.0	E	Nitric acid	[N+](=O)(O)[O-]
HNO4	Pernitric acid	G	79.0	E	Hydroxy nitrate	[N+](=O)([O-])OO
HO	Hydroxy radical	G	17.0	E	Hydroxyl radical	[OH]
HO2	Hydroperoxy radical	G	33.0	E	Hydroperoxy	O[O-]
HOM	Highly oxygenated molecules from terpenes	GP	250.0	L	6,7-dihydroperoxy-3,3,6-trimethyl-tetrahydro-3aH-1,2-benzodioxol-5-ol	OC1CC2C(OOC2(C)C)C(OO)C1(C)OO
HONO	Nitrous acid	G	47.0	E	Nitrous acid	N(=O)O
IEPOX	isoprene epoxydiols	G	118.1	E	Isoprene epoxydiol	OCC1OC1(C)CO
IEPOXP	IEPOX intermediate (tracking species)	G	118.1		NA
ISHP	Beta-hydroxy hydroperoxides from ISOP+HO2	G	118.0	L	2-hydroperoxy-2-methylbut-3-en-1-ol	C=CC(OO)(CO)C
ISO	Isoprene	G	68.1	E	Isoprene	CC(=C)C=C
ISON	Beta-hydroxyalkylnitrates from ISOP+NO alkylnitrates from ISO+NO3	G	147.0	L	2-methyl-2-(nitrooxy)but-3-en-1-ol	OCC(C)(C=C)ON(=O)=O
ISOP	Peroxy radicals formed from ISO+HO	G	117.0	L	(1-hydroxy-3-methylbut-3-en-2-yl)peroxy	OCC(O[O])C(C)=C
KET	ketones	G	86.0	L	Diethylketone	CCC(=O)CC
KETP	Peroxy radicals formed from KET	G	117.0	L	(3-oxopentan-2-yl)peroxy	CCC(C(C)O[O])=O
LIM	d-limonene and other cyclic diene-terpenes	G	136.3	L	D-Limonene	CC(=C)[C@@H]1CCC(C)=CC1
LIMAL	Limonene aldehyde and similar LIM-derived aldehydes	G	168.0	L	Limonaldehyde	O=CCC(CCC(=O)C)C(=C)C
LIMALP	Peroxy radicals from LIMAL	G	217.0	L	[1-hydroxy-2-methyl-5-oxo-3-(3-oxobutyl)pentan-2-yl]peroxy	O=CCC(CCC(=O)C)C(C)(CO)O[O]
LIMNP1	Peroxy radicals from LIM+NO3 that do not undergo autoxidation	G	230.0	L	[1-methyl-2-(nitrooxy)-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O-][N+](=O)OC1CC(CCC1(C)O[O])C(=C)C
LIMNP2	Peroxy radicals from LIM+NO3 that undergo autoxidation	G	230.0	L	[1-methyl-2-(nitrooxy)-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O-][N+](=O)OC1CC(CCC1(C)O[O])C(=C)C
LIMP1	Peroxy radicals from LIM+OH that do not undergo autoxidation	G	185.0	L	[2-hydroxy-1-methyl-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O]OC1(C)CCC(CC1O)C(=C)C
LIMP2	Peroxy radicals from LIM+OH that undergo autoxidation	G	185.0	L	[2-hydroxy-1-methyl-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O]OC1(C)CCC(CC1O)C(=C)C
MACP	Peroxy radicals formed from MACR+HO	G	101.0	L	(2-methylprop-2-enoyl)peroxy	CC(=C)C(=O)O[O]
MACR	methacrolein and other C4 aldehydes	G	70.0	L	Methacrolein	CC(=C)C=O
MAHP	Hydroperoxides from MACP+HO2	G	102.0	L	2-methylprop-2-eneperoxoic acid	C=C(C)C(OO)=O
MCP	Peroxy radical formed from MACR + HO which does not form MPAN	G	119.0	L	(1-hydroxy-2-methyl-3-oxopropan-2-yl)peroxy	OCC(C)(O[O])C=O
MCT	Methyl catechol	G	124.1	L	4-Methylcatechol	CC1=CC(O)=C(O)C=C1
MCTO	Alkoxy radical formed from MCT+HO and MCT+NO3	G	123.0	L	3-hydroxy-5-methylphenyloxidanyl	CC1=CC(O)=CC([O])=C1
MCTP	Radical formed fro MCT+O3 reaction	G	172.0	L	C7H8O5 Biradical	CC(/C=C\[C](O[O])O)=C/C(O)=O
MEK	Methyl ethyl ketone	G	72.1	E	Methyl ethyl ketone	CCC(C)=O
MEKP	Peroxy radicals formed from MEK	G	103.0	L	(3-oxobutyl)peroxy	[O]OCCC(=O)C
MGLY	Methylglyoxal and other alpha-carbonyl aldehydes	G	72.0	L	Methyl glyoxal	CC(=O)C=O
MO2	Methyl peroxy radical	G	47.0	E	Methylperoxy	CO[O]
MOH	Methanol	G	32.0	E	Methanol	CO
MPAN	Peroxymethacryloylnitrate and other higher peroxyacylnitrates from isoprene oxidation	G	147.1	L	Peroxymethacryloyl nitrate	O=N(=O)OOC(=O)C(=C)C
MVK	Methyl vinyl ketone	G	70.1	E	Methyl vinyl ketone	CC(=O)C=C
MVKP	Peroxy radicals formed from MVK	G	119.0	L	(2-hydroxy-3-oxobutyl)peroxy	CC(=O)C(O)CO[O]
N2O5	Dinitrogen pentoxide	G	108.0	E	Dinitrogen pentoxide	[N+](=O)([O-])O[N+](=O)[O-]
NALD	Nitrooxyacetaldehyde	G	105.0	E	1-(nitrooxy)acetaldehyde	O=CCON(=O)=O
NAPH	Naphthalene and other PAHs	G	128.17	L	Naphthalene	C1=CC2=CC=CC=C2C=C1
NAPHP	Peroxy radicals from NAPH oxidation	G	209.17	L	{8-hydroxy-10,11-dioxatricyclo[7.2.1.0^{2,7}]dodeca-2,4,6-trien-12-yl}peroxy	C12=CC=CC=C1C3OOC(C3O[O])C2(O)
NH3	Ammonia	G	17.0	E	Ammonia	N
NO	Nitric oxide	G	30.0	E	Nitric oxide	[N]=O
NO2	Nitrogen dioxide	G	46.0	E	Nitrogen dioxide	N(=O)[O]
NO3	Nitrogen trioxide	G	62.0	E	Nitrate radical	[O]N(=O)=O
NUM	Number of particles	P	1.0	L	Number of particles
O1D	Excited state oxygen atom, O(1D)	G	16.0	E	Excited oxygen	[O]
O3	Ozone	G	48.0	E	Ozone	[O-][O+]=O
O3P	Ground state oxygen atom, O(3P)	G	16.0	E	Ground state oxygen	[O]
OLI	Internal alkenes	G	70.1	L	2-Methyl-2-butene	CC=C(C)C
OLIP	Peroxy radicals formed from OLI	G	119.0	L	(3-hydroxy-2-methylbutan-2-yl)peroxy	[O]OC(C)(C)C(C)O
OLND	NO3-alkene adduct reacting via decomposition	G	136.0	L	[1-(nitrooxy)propan-2-yl]peroxy	CC(O[O])CO[N+]([O-])=O
OLNN	NO3-alkene adduct reacting to form carbonitrates + HO2	G	136.0	L	[1-(nitrooxy)propan-2-yl]peroxy	CC(O[O])CO[N+]([O-])=O
OLT	Terminal alkenes	G	42.0	L	1-Propene	CC=C
OLTP	Peroxy radicals formed from OLT	G	91.0	L	(1-hydroxypropan-2-yl)peroxy	CC(CO)O[O]
ONIT	Organic nitrates	G	119.0	L	Butan-2-yl nitrate	CCC(C)O[N+](=O)[O-]
OP1	Methyl hydrogen peroxide	G	48.0	E	Methyl hydroperoxide	COO
OP2	Higher organic peroxides	G	62.0	L	Ethyl hydroperoxide	CCOO
OP3	Semivolatile organic peroxide	GP	176.2	L	5-hydroperoxy-6-hydroxyoctan-3-one	CCC(=O)CC(OO)C(O)CC
OPB	Terpene-derived peroxides	G	186.2	L	2-hydroperoxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol	OOC1(C)C(O)CC2CC1C2(C)C
ORA1	Formic acid	G	46.0	E	Formic acid	OC=O
ORA2	Acetic acid and higher acids	G	60.2	L	Acetic acid	CC(O)=O
ORAP	Peroxy radical formed from ORA2 + HO reaction	G	91.0	L	(carboxymethyl)peroxy	[O]OCC(=O)O
PAA	Peroxyacetic acids and higher analogs	G	76.0	L	Peroxyacetic acid	CC(=O)OO
PAN	Peroxyacetyl nitrate and higher saturated PANs	G	121.0	L	Peroxyacetyl nitrate	CC(=O)OON(=O)=O
PHEN	phenol and benzene diols	G	110.1	L	Resorcinol	OC1=CC(O)=CC=C1
PINAL	Pinonaldehyde and similar APIN-derived aldehydes	G	168.0	L	Pinonaldehyde	O=CCC1CC(C(=O)C)C1(C)C
PINALP	Peroxy radicals from PINAL oxidation	G	199.0	L	[3-acetyl-2,2-dimethyl-1-(2-oxoethyl)cyclobutyl]peroxy	O=CCC1(O[O])CC(C(=O)C)C1(C)C
PPN	Peroxypropionyl nitrate	G	135.0	E	Peroxypopionyl nitrate	CCC(=O)OO[N+](=O)[O-]
PROG	Propylene glyocol and other 3 carbon dialcohols	G	76.1	E	1,2-Propylene glycol	CC(O)CO
RCO3	Higher saturated acyl peroxy radicals	G	89.0	L	Propanoylperoxy	CCC(=O)O[O]
ROCIOXY	Intermediate volatility oxygenated ROC species (directly emitted)	G	247.0	L	Decamethylcyclopentasiloxane	C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1
ROCN1ALK	Alkane-like ROC species with C* of 10-1 μg m-3	GP	408.8	L	5,9-Dimethylheptacosane	CCCCCCCCCCCCCCCCCCC(C)CCCC(C)CCCC
ROCN1OXY1	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.1	GP	312.5	L	Arachidic Acid	CCCCCCCCCCCCCCCCCCCC(=O)O
ROCN1OXY3	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.3	GP	230.3	L	DODECANEDIOIC ACID	C(CCCCCC(=O)O)CCCCC(=O)O
ROCN1OXY6	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.6	GP	190.2	L	2-hydroxy-octanedioic acid	C(CCC(C(=O)O)O)CCC(=O)O
ROCN2ALK	Alkane-like ROC species with C* of 10-2 μg m-3	GP	422.83	L	Triacontane	CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
ROCN2OXY2	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.2	GP	282.4	L	12(S)-hydroxy-16-Heptadecynoic Acid	C#CCCC[C@H](CCCCCCCCCCC(=O)O)O
ROCN2OXY4	Oxygenated ROC species with C* of 10-2 μg m-3 and O:C of 0.4	GP	232.3	L	2-HYDROXYUNDECANEDIOIC ACID	C(CCCCC(=O)O)CCCC(C(=O)O)O
ROCN2OXY8	Oxygenated ROC species with C* of 10-2 μg m-3 and O:C of 0.8	GP	194.2	L	3,4,5,6,7-Pentahydroxyheptan-2-one	CC(=O)C(C(C(C(CO)O)O)O)O
ROCP0ALK	Alkane-like ROC species with C* of 1 μg m-3	GP	394.77	L	11-Methylheptacosane	CCCCCCCCCCCCCCCCC(C)CCCCCCCCCC
ROCP0OXY2	Oxygenated ROC species with C* of 1 μg m-3 and O:C of 0.2	GP	242.4	L	3-oxotetradecanoic acid	CCCCCCCCCCCC(=O)CC(=O)O
ROCP0OXY4	Oxygenated ROC species with C* of 1 μg m-3 and O:C of 0.4	GP	202.3	L	DECANEDIOIC ACID	C(CCCCC(=O)O)CCCC(=O)O
ROCP1ALK	Alkane-like ROC species with C* of 10 μg m-3	GP	380.75	L	Heptacosane	CCCCCCCCCCCCCCCCCCCCCCCCCCC
ROCP1ALKP	Peroxy radicals from ROCP1ALK oxidation	G	411.74	L	heptacosan-3-ylperoxy	CCCCCCCCCCCCCCCCCCCCCCCCC(CC)O[O]
ROCP1ALKP2	Hydroxy peroxy radicals from ROCP1ALK alkoxy product	G	427.73	L	(3-hydroxyheptacosan-6-yl)peroxy	CCCCCCCCCCCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP1OXY1	Oxygenated ROC species with C* of 10 μg m-3 and O:C of 0.1	GP	270.5	L	HEPTADECANOIC ACID	CCCCCCCCCCCCCCCCC(=O)O
ROCP1OXY3	Oxygenated ROC species with C* of 10 μg m-3 and O:C of 0.3	GP	202.3	L	11-hydroxyundecanoic acid	C(CCCCCO)CCCCC(=O)O
ROCP2ALK	Alkane-like ROC species with C* of 10+2 μg m-3	GP	338.66	L	Tetracosane	CCCCCCCCCCCCCCCCCCCCCCCC
ROCP2ALKP	Peroxy radicals from ROCP2ALK oxidation	G	369.65	L	tetracosan-3-ylperoxy	CCCCCCCCCCCCCCCCCCCCCC(CC)O[O]
ROCP2ALKP2	Hydroxy peroxy radicals from ROCP2ALK alkoxy product	G	385.65	L	(3-hydroxytetracosan-6-yl)peroxy	CCCCCCCCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP2OXY2	Oxygenated ROC species with C* of 10+2 μg m-3 and O:C of 0.2	GP	200.3	L	Dodecanoic Acid	CCCCCCCCCCCC(=O)O
ROCP3ALK	Alkane-like ROC species with C* of 10+3 μg m-3	GP	296.58	L	Heneicosane	CCCCCCCCCCCCCCCCCCCCC
ROCP3ALKP	Peroxy radicals from ROCP3ALK oxidation	G	327.57	L	henicosan-3-ylperoxy	CCCCCCCCCCCCCCCCCCC(CC)O[O]
ROCP3ALKP2	Hydroxy peroxy radicals from ROCP3ALK alkoxy product	G	343.57	L	(3-hydroxyhenicosan-6-yl)peroxy	CCCCCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP3OXY2	Oxygenated ROC species with C* of 10+3 μg m-3 and O:C of 0.2	GP	186.3	L	11-hydroxyundecanal	C(CCCCCO)CCCCC=O
ROCP4ALK	Alkane-like ROC species with C* of 10+4 μg m-3	G	254.5	L	Octadecane	CCCCCCCCCCCCCCCCCC
ROCP4ALKP	Peroxy radicals from ROCP4ALK oxidation	G	285.49	L	octadecan-3-ylperoxy	CCCCCCCCCCCCCCCC(CC)O[O]
ROCP4ALKP2	Hydroxy peroxy radicals from ROCP4ALK alkoxy product	G	301.49	L	(3-hydroxyoctadecan-6-yl)peroxy	CCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP4OXY2	Oxygenated ROC species with C* of 10+4 μg m-3 and O:C of 0.2	G	158.2	L	2-Ethylheptanoic Acid	CCCCCC(CC)C(=O)O
ROCP5ALK	Alkane-like ROC species with C* of 10+5 μg m-3	G	198.39	L	Tetradecane	CCCCCCCCCCCCCC
ROCP5ALKP	Peroxy radicals from ROCP5ALK oxidation	G	229.38	L	tetradecan-3-ylperoxy	CCCCCCCCCCCC(CC)O[O]
ROCP5ALKP2	Hydroxy peroxy radicals from ROCP5ALK alkoxy product	G	245.38	L	(3-hydroxytetradecan-6-yl)peroxy	CCCCCCCCC(O[O])CCC(O)CC
ROCP5ARO	Aromatic ROC species with C* of 10+5 μg m-3	G	190.33	L	Benzene, octyl-	CCCCCCCCC1=CC=CC=C1
ROCP5AROP	Peroxy radicals from ROCP5ARO oxidation	G	271.33	L	{8-hydroxy-5-octyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	CCCCCCCCC1(OO2)C=CC(O[O])C2C1O
ROCP5OXY1	Oxygenated ROC species with C* of 10+5 μg m-3 and O:C of 0.1	G	170.3	L	Undecanal	CCCCCCCCCCC=O
ROCP6ALK	Alkane-like ROC species with C* of 10+6 μg m-3	G	184.37	L	Tridecane	CCCCCCCCCCCCC
ROCP6ALKP	Peroxy radicals from ROCP6ALK oxidation	G	215.36	L	tridecan-3-ylperoxy	CCCCCCCCCCC(CC)O[O]
ROCP6ALKP2	Hydroxy peroxy radicals from ROCP6ALK alkoxy product	G	231.36	L	(3-hydroxytridecan-6-yl)peroxy	CCCCCCCC(O[O])CCC(O)CC
ROCP6ARO	Aromatic ROC species with C* of 10+6 μg m-3	G	176.3	L	1-Hexyl-4-methylbenzene	CCCCCCC1=CC=C(C)C=C1
ROCP6AROP	Peroxy radicals from ROCP6ARO oxidation	G	257.3	L	{2-hexyl-8-hydroxy-5-methyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	OC1C2C(CCCCCC)(O[O])C=CC1(C)OO2
ROCP6OXY1	Oxygenated ROC species with C* of 10+6 μg m-3 and O:C of 0.1	G	142.2	L	Nonanal	CCCCCCCCC=O
ROH	C3 and higher alcohols	G	60.0	L	Propanol	CCCO
SESQ	Sesquiterpenes	G	204.4	L	b-caryophyllene	C/C1=C/CCC(=C)C2CC(C)(C)C2CC\1
SESQNRO2	Peroxy radicals from SESQ reaction with nitrate radicals	G	298.4	L	[4,11,11-trimethyl-8-methylidene-5-(nitrooxy)bicyclo[7.2.0]undecan-4-yl]peroxy	[O]OC1(C)CCC2C(CC2(C)C)C(=C)CCC1O[N+](=O)[O-]
SESQRO2	Peroxy radicals from SESQ reaction with OH	G	253.4	L	{5-hydroxy-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undecan-4-yl}peroxy	[O]OC1(C)CCC2C(CC2(C)C)C(=C)CCC1O
SLOWROC	Slowly reacting ROC with kOH< 3.5x10-13 cm3 s-1	G	75.4	L	Hydrogen cyanide	C#N
SO2	Sulfur dioxide	G	64.0	E	Sulfur dioxide	O=S=O
SRF	Surface area of particles	P	1.0	L	Surface area of particles
SULF	Sulfuric acid	G	98.0	E	Sulfuric acid	OS(=O)(=O)O
SULRXN	Precursor of Aerosol Sulfate (tracking species)	G	98.0		NA
TOL	Toluene	G	92.14	E	Toluene	CC1=CC=CC=C1
TOLP	Peroxy radicals formed from TOL	G	173.14	L	{8-hydroxy-5-methyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2(C)OOC1C2O
TRPN	Terpene nitrates	G	215.0	L	3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl nitrate	O=N(=O)OC1(C)C(O)CC2CC1C2(C)C
UALD	Unsaturated aldehydes	G	84.1	L	2-Methylbut-2-enal	CC=C(C)C=O
UALP	Peroxy radicals formed from UALD	G	133.0	L	(3-hydroxy-3-methyl-4-oxobutan-2-yl)peroxy	CC(O[O])C(C)(O)C=O
XO2	Accounts for addition NO to NO2 conversions (tracking species)	G	1.0		NA
XYE	O- and p-xylene and other less reactive volatile aromatics with kOH < 1.46x10-11 cm3 s-1	G	106.2	L	Ethylbenzene	CCC1=CC=CC=C1
XYEP	Peroxy radicals formed from XYE	G	187.17	L	{5-ethyl-8-hydroxy-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2(CC)OOC1C2O
XYM	M-xylene and other more reactive volatile aromatics with kOH > 1.46x10-11 cm3 s-1	G	106.2	L	m-Xylene	CC1=CC(C)=CC=C1
XYMP	Peroxy radicals formed from XYM	G	187.17	L	{8-hydroxy-1,5-dimethyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2(C)OOC1(C)C2O