CRACMM1 Species Table

Gas (G) and particle (P) species from the namelists. SMILES link to representative structures in the EPA Chemicals Dashboard (if available).

Note that for each particulate species in CMAQ, a letter will be appended to the name to designate the size, or mode, of the aerosol being represented: I = Aitken mode, J = Accumulation mode, K = Coarse mode. Prepending of a species with a V or A in CMAQ or the chemical mechanism files indicates the species resides in the gas or particulate phase.

Species	Description	Phase	Molecular Weight (g/mol)	Explicit/ Lumped	Representative Structure	SMILES
AAL	Aluminum ion	P	27.0	E	Aluminum ion	[Al+3]
ACA	Calcium ion	P	40.1	E	Calcium ion	[Ca++]
ACD	Acetaldehyde	G	44.0	E	Acetaldehyde	CC=O
ACE	Acetylene	G	26.0	E	Acetylene	C#C
ACL	Chloride ion	P	35.5	E	Chloride ion	[Cl-]
ACO3	Acetyl peroxy radicals	G	75.0	E	Acetylperoxy	CC(=O)O[O]
ACORS	Primary unspeciated coarse PM	P	100.0	L	Coarse PM
ACRO	Acrolein	G	56.1	E	Acrolein	C=CC=O
ACT	Acetone	G	58.0	E	Acetone	CC(C)=O
ACTP	Peroxy radicals formed from ACT	G	89.0	E	(2-oxopropyl)peroxy	CC(=O)CO[O]
ADCN	Aromatic-NO3 adduct from PHEN	G	155.0	L	4-oxocyclohex-2-en-1-yl nitrate	OC1=C[C]C(O[N+]([O-])=O)C=C1
ADDC	Aromatic-HO adduct from CSL	G	125.0	L	3-methyl-5-oxocyclohex-3-en-1-yloxidanyl	CC1=CC(O)=CC([O])C1
AEC	Elemental carbon	P	12.0	L	Carbon	[C]
AFE	Iron ion	P	55.8	E	Iron ion	[Fe++]
AGLY	SOA from reactive uptake of glyoxal on particles	P	66.4	L	2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol	OC2OC(C1OC(O)C(O)O1)OC2O
AH2O	Water associated with particulate inorganic compounds	P	18.0	E	Water	O
AH3OP	Hydronium ion tracer	P	19.0	E	Hydronium ion	[OH3+]
AISO3NOS	Non-sulfated SOA from IEPOX uptake	P	136.2	L	2-methylbutane-1,2,3,4-tetrol	C(O)C(O)(C)C(O)CO
AISO3OS	Organosulfate SOA from IEPOX uptake	P	216.2	L	(1,3,4-trihydroxy-2-methylbutan-2-yl)oxysulfonic acid	C(O)C(OS(O)(=O)(=O))(C)C(O)CO
AK	Potassium ion	P	39.1	E	Potassium ion	[K+]
ALD	C3 and higher aldehydes	G	58.0	L	Propanal	CCC=O
AMG	Magnesium ion	P	24.3	E	Magnesium ion	[Mg++]
AMN	Manganese ion	P	54.9	L	Manganese ions	[Mn++]
ANA	Sodium ion	P	23.0	E	Sodium ion	[Na+]
ANH4	Ammonium ion	P	18.0	E	Ammonium ion	[NH4+]
ANO3	Nitrate ion	P	62.0	E	Nitrate ion	[N+](=O)([O-])[O-]
AORGC	SOA from cloud processing of GLY and MGLY	P	177.0	L	2-(4,5-dihydroxy-1,3-dioxolan-2-yl)-1,3-dioxolane-4,5-diol	OC2OC(C1OC(O)C(O)O1)OC2O
AORGH2O	Water associated with particulate organic compounds	P	18.0	E	Water	O
AOTHR	Primary unspeciated fine PM	P	200.0	L	Unspeciated PM
API	Alpha-pinenes and other cyclic terpenes with one double bond	G	136.4	L	alpha-pinene	CC1=CCC2CC1C2(C)C
APINP1	Peroxy radicals from API+NO3 that do not undergo autoxidation	G	230.0	L	[2,6,6-trimethyl-3-(nitrooxy)bicyclo[3.1.1]heptan-2-yl]peroxy	[O]OC1(C)C(ON(=O)=O)CC2CC1C2(C)C
APINP2	Peroxy radicals from API+NO3 that undergo autoxidation	G	230.0	L	[2,6,6-trimethyl-3-(nitrooxy)bicyclo[3.1.1]heptan-2-yl]peroxy	[O]OC1(C)C(ON(=O)=O)CC2CC1C2(C)C
APIP1	Peroxy radicals from API+OH that do not undergo autoxidation	G	185.0	L	{3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl}peroxy	[O]OC1(C)C(O)CC2CC1C2(C)C
APIP2	Peroxy radicals from API+OH that undergo autoxidation	G	185.0	L	{3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl}peroxy	[O]OC1(C)C(O)CC2CC1C2(C)C
APNCOM	Primary non-carbon organic matter (legacy)	P	220.0	L	Non-carbon organic matter
APOC	Primary organic carbon (legacy)	P	220.0	L	Organic carbon
ASEACAT	Sea spray cations	P	23.75	L	Coarse sea spray cations
ASI	Silicon	P	28.1	E	Total Silicon	[Si]
ASO4	Total sulfur IV as sulfate	P	96.0	L	Sulfate ion	[O-]S(=O)(=O)[O-]
ASOAT	An empirical SOA	P	200.0	L	3,4,5,6,7-Pentahydroxyheptan-2-one	CC(=O)C(C(C(C(CO)O)O)O)O
ASOIL	Lumped crustal species	P	100.0	L	Crustal species
ATI	Titanium	P	47.9	E	Total Titanium	[Ti]
BAL1	Peroxy radicals formed from BALD	G	123.0	L	(4-methylphenyl)peroxy	[O]OC1=CC=C(C)C=C1
BAL2	Peroxy radicals formed from BALD	G	109.0	L	phenylperoxy	[O]OC1=CC=CC=C1
BALD	Benzaldehyde and other aromatic aldehydes	G	106.0	L	Benzaldehyde	O=CC1=CC=CC=C1
BALP	Peroxy radicals formed from BALD	G	137.0	L	benzoylperoxy	O=C(O[O])C1=CC=CC=C1
BDE13	1,3-butadiene	G	54.1	E	1,3-Butadiene	C=CC=C
BDE13P	Peroxy radicals from BDE13	G	103.0	L	(1-hydroxybut-3-en-2-yl)peroxy	C=CC(O[O])CO
BEN	Benzene	G	78.11	E	Benzene	C1=CC=CC=C1
BENP	Peroxy radicals formed from benzene	G	159.12	L	{8-hydroxy-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2OOC1C2O
CHO	Phenoxy radical formed from CSL	G	139.0	L	4-hydroxy-3,5-dimethylcyclohexa-2,5-dien-1-yloxidanyl	[O]C1C=C(C)C(O)C(=C1)C
CO	Carbon monoxide	G	28.0	E	Carbon monoxide	[C-]#[O+]
CSL	Cresol and other hydroxy substituted aromatics	G	136.2	L	2-Phenylpropan-2-ol	CC(C)(O)C1=CC=CC=C1
DCB1	Unsaturated dicarbonyls	G	98.0	L	2-methylbut-2-enedial	O=CC=C(C)C=O
DCB2	Unsaturated dicarbonyls	G	112.1	L	2-methyl-4-oxopent-2-enal	O=CC(=CC(=O)C)C
DCB3	Unsaturated dicarbonyls	G	84.0	L	but-2-enedial	O=CC=CC=O
ELHOM	Extremely-low volatility highly oxygenated molecules from terpenes	GP	402.0	L	6-hydroperoxy-7-({3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl}peroxy)-3,3,6-trimethyl-tetrahydro-3aH-1,2-benzodioxol-5-ol	OC1CC2C(OOC2(C)C)C(OOC3(C)C4C(C)(C)C(C4)CC3O)C1(C)OO
EOH	Ethanol	G	46.1	E	Ethanol	CCO
ETE	ethene	G	28.1	E	Ethylene	C=C
ETEG	Ethylene glycol	G	62.1	E	Ethylene glycol	OCCO
ETEP	Peroxy radicals formed from ETE	G	77.0	E	(2-hydroxyethyl)peroxy	OCCO[O]
ETH	ethane	G	30.1	E	Ethane	CC
ETHP	Peroxy radicals formed from ethane and other species	G	61.0	L	Ethylperoxy	CCO[O]
FURAN	Furans and other dienes	G	96.1	L	Furfural	O=CC1=CC=CO1
FURANO2	Peroxy radicals from FURAN oxidation	G	145.1	L	(2-formyl-5-hydroxy-5H-furan-2-yl)peroxy	OC1C=CC(O1)(O[O])(C=O)
FURANONE	Ring-retaining ketone product from FURAN oxidation	G	100.1	L	2-hydroxy-2H-furan-5-one	C1=CC(=O)OC1O
GLY	Glyoxal and glycoaldehydes	G	58.0	L	Glyoxal	O=CC=O
H2O2	Hydrogen peroxide	G	34.0	E	Hydrogen peroxide	OO
HC10	Alkanes and other species with HO rate constant greater than 6.8x10-12 cm3 s-1	G	142.28	L	Decane	CCCCCCCCCC
HC10P	Peroxy radicals formed from HC10	G	173.27	L	Decan-3-ylperoxy	CCCCCCCC(CC)O[O]
HC10P2	Hydroxy peroxy radicals from HC10P alkoxy product	G	189.27	L	(8-hydroxydecan-5-yl)peroxy	CCCCC(O[O])CCC(O)CC
HC3	Alkanes and other species with HO rate constant less than 3.4x10-12 cm3 s-1	G	44.1	L	Propane	CCC
HC3P	Peroxy radicals formed from HC3	G	75.0	L	Isopropyl peroxy	CC(C)O[O]
HC5	Alkanes and other species with HO rate constant between 3.4x10-12 and 6.8x10-12 cm3 s-1	G	72.1	L	Pentane	CCCCC
HC5P	Peroxy radicals formed from HC5	G	103.0	L	Pentan-3-ylperoxy	CCC(O[O])CC
HCHO	Formaldehyde	G	30.0	E	Formaldehyde	C=O
HCL	Hydrochloric acid	G	36.0	E	Hydrochloric acid	Cl
HKET	Hydroxy ketone	G	74.0	L	Hydroxy acetone	CC(=O)CO
HNO3	Nitric acid	G	63.0	E	Nitric acid	[N+](=O)(O)[O-]
HNO4	Pernitric acid	G	79.0	E	Hydroxy nitrate	[N+](=O)([O-])OO
HO	Hydroxy radical	G	17.0	E	Hydroxyl radical	[OH]
HO2	Hydroperoxy radical	G	33.0	E	Hydroperoxy	O[O-]
HOM	Highly oxygenated molecules from terpenes	GP	250.0	L	6,7-dihydroperoxy-3,3,6-trimethyl-tetrahydro-3aH-1,2-benzodioxol-5-ol	OC1CC2C(OOC2(C)C)C(OO)C1(C)OO
HONO	Nitrous acid	G	47.0	E	Nitrous acid	N(=O)O
IEPOX	isoprene epoxydiols	G	118.1	E	Isoprene epoxydiol	OCC1OC1(C)CO
IEPOXP	IEPOX intermediate (tracking species)	G	118.1		NA
ISHP	Beta-hydroxy hydroperoxides from ISOP+HO2	G	118.0	L	2-hydroperoxy-2-methylbut-3-en-1-ol	C=CC(OO)(CO)C
ISO	Isoprene	G	68.1	E	Isoprene	CC(=C)C=C
ISON	Beta-hydroxyalkylnitrates from ISOP+NO alkylnitrates from ISO+NO3	G	147.0	L	2-methyl-2-(nitrooxy)but-3-en-1-ol	OCC(C)(C=C)ON(=O)=O
ISOP	Peroxy radicals formed from ISO+HO	G	117.0	L	(1-hydroxy-3-methylbut-3-en-2-yl)peroxy	OCC(O[O])C(C)=C
KET	ketones	G	86.0	L	Diethylketone	CCC(=O)CC
KETP	Peroxy radicals formed from KET	G	117.0	L	(3-oxopentan-2-yl)peroxy	CCC(C(C)O[O])=O
LIM	d-limonene and other cyclic diene-terpenes	G	136.3	L	D-Limonene	CC(=C)[C@@H]1CCC(C)=CC1
LIMAL	Limonene aldehyde and similar LIM-derived aldehydes	G	168.0	L	Limonaldehyde	O=CCC(CCC(=O)C)C(=C)C
LIMALP	Peroxy radicals from LIMAL	G	217.0	L	[1-hydroxy-2-methyl-5-oxo-3-(3-oxobutyl)pentan-2-yl]peroxy	O=CCC(CCC(=O)C)C(C)(CO)O[O]
LIMNP1	Peroxy radicals from LIM+NO3 that do not undergo autoxidation	G	230.0	L	[1-methyl-2-(nitrooxy)-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O-][N+](=O)OC1CC(CCC1(C)O[O])C(=C)C
LIMNP2	Peroxy radicals from LIM+NO3 that undergo autoxidation	G	230.0	L	[1-methyl-2-(nitrooxy)-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O-][N+](=O)OC1CC(CCC1(C)O[O])C(=C)C
LIMP1	Peroxy radicals from LIM+OH that do not undergo autoxidation	G	185.0	L	[2-hydroxy-1-methyl-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O]OC1(C)CCC(CC1O)C(=C)C
LIMP2	Peroxy radicals from LIM+OH that undergo autoxidation	G	185.0	L	[2-hydroxy-1-methyl-4-(prop-1-en-2-yl)cyclohexyl]peroxy	[O]OC1(C)CCC(CC1O)C(=C)C
MACP	Peroxy radicals formed from MACR+HO	G	101.0	L	(2-methylprop-2-enoyl)peroxy	CC(=C)C(=O)O[O]
MACR	methacrolein and other C4 aldehydes	G	70.0	L	Methacrolein	CC(=C)C=O
MAHP	Hydroperoxides from MACP+HO2	G	102.0	L	2-methylprop-2-eneperoxoic acid	C=C(C)C(OO)=O
MCP	Peroxy radical formed from MACR + HO which does not form MPAN	G	119.0	L	(1-hydroxy-2-methyl-3-oxopropan-2-yl)peroxy	OCC(C)(O[O])C=O
MCT	Methyl catechol	G	124.1	L	4-Methylcatechol	CC1=CC(O)=C(O)C=C1
MCTO	Alkoxy radical formed from MCT+HO and MCT+NO3	G	123.0	L	3-hydroxy-5-methylphenyloxidanyl	CC1=CC(O)=CC([O])=C1
MCTP	Radical formed fro MCT+O3 reaction	G	172.0	L	C7H8O5 Biradical	CC(/C=C\[C](O[O])O)=C/C(O)=O
MEK	Methyl ethyl ketone	G	72.1	E	Methyl ethyl ketone	CCC(C)=O
MEKP	Peroxy radicals formed from MEK	G	103.0	L	(3-oxobutyl)peroxy	[O]OCCC(=O)C
MGLY	Methylglyoxal and other alpha-carbonyl aldehydes	G	72.0	L	Methyl glyoxal	CC(=O)C=O
MO2	Methyl peroxy radical	G	47.0	E	Methylperoxy	CO[O]
MOH	Methanol	G	32.0	E	Methanol	CO
MPAN	Peroxymethacryloylnitrate and other higher peroxyacylnitrates from isoprene oxidation	G	147.1	L	Peroxymethacryloyl nitrate	O=N(=O)OOC(=O)C(=C)C
MVK	Methyl vinyl ketone	G	70.1	E	Methyl vinyl ketone	CC(=O)C=C
MVKP	Peroxy radicals formed from MVK	G	119.0	L	(2-hydroxy-3-oxobutyl)peroxy	CC(=O)C(O)CO[O]
N2O5	Dinitrogen pentoxide	G	108.0	E	Dinitrogen pentoxide	[N+](=O)([O-])O[N+](=O)[O-]
NALD	Nitrooxyacetaldehyde	G	105.0	E	1-(nitrooxy)acetaldehyde	O=CCON(=O)=O
NAPH	Naphthalene and other PAHs	G	128.17	L	Naphthalene	C1=CC2=CC=CC=C2C=C1
NAPHP	Peroxy radicals from NAPH oxidation	G	209.17	L	{8-hydroxy-10,11-dioxatricyclo[7.2.1.0^{2,7}]dodeca-2,4,6-trien-12-yl}peroxy	C12=CC=CC=C1C3OOC(C3O[O])C2(O)
NH3	Ammonia	G	17.0	E	Ammonia	N
NO	Nitric oxide	G	30.0	E	Nitric oxide	[N]=O
NO2	Nitrogen dioxide	G	46.0	E	Nitrogen dioxide	N(=O)[O]
NO3	Nitrogen trioxide	G	62.0	E	Nitrate radical	[O]N(=O)=O
NUM	Number of particles	P	1.0	L	Number of particles
O1D	Excited state oxygen atom, O(1D)	G	16.0	E	Excited oxygen	[O]
O3	Ozone	G	48.0	E	Ozone	[O-][O+]=O
O3P	Ground state oxygen atom, O(3P)	G	16.0	E	Ground state oxygen	[O]
OLI	Internal alkenes	G	70.1	L	2-Methyl-2-butene	CC=C(C)C
OLIP	Peroxy radicals formed from OLI	G	119.0	L	(3-hydroxy-2-methylbutan-2-yl)peroxy	[O]OC(C)(C)C(C)O
OLND	NO3-alkene adduct reacting via decomposition	G	136.0	L	[1-(nitrooxy)propan-2-yl]peroxy	CC(O[O])CO[N+]([O-])=O
OLNN	NO3-alkene adduct reacting to form carbonitrates + HO2	G	136.0	L	[1-(nitrooxy)propan-2-yl]peroxy	CC(O[O])CO[N+]([O-])=O
OLT	Terminal alkenes	G	42.0	L	1-Propene	CC=C
OLTP	Peroxy radicals formed from OLT	G	91.0	L	(1-hydroxypropan-2-yl)peroxy	CC(CO)O[O]
ONIT	Organic nitrates	G	119.0	L	Butan-2-yl nitrate	CCC(C)O[N+](=O)[O-]
OP1	Methyl hydrogen peroxide	G	48.0	E	Methyl hydroperoxide	COO
OP2	Higher organic peroxides	G	62.0	L	Ethyl hydroperoxide	CCOO
OP3	Semivolatile organic peroxide	GP	176.2	L	5-hydroperoxy-6-hydroxyoctan-3-one	CCC(=O)CC(OO)C(O)CC
OPB	Terpene-derived peroxides	G	186.2	L	2-hydroperoxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-ol	OOC1(C)C(O)CC2CC1C2(C)C
ORA1	Formic acid	G	46.0	E	Formic acid	OC=O
ORA2	Acetic acid and higher acids	G	60.2	L	Acetic acid	CC(O)=O
ORAP	Peroxy radical formed from ORA2 + HO reaction	G	91.0	L	(carboxymethyl)peroxy	[O]OCC(=O)O
PAA	Peroxyacetic acids and higher analogs	G	76.0	L	Peroxyacetic acid	CC(=O)OO
PAN	Peroxyacetyl nitrate and higher saturated PANs	G	121.0	L	Peroxyacetyl nitrate	CC(=O)OON(=O)=O
PHEN	phenol and benzene diols	G	110.1	L	Resorcinol	OC1=CC(O)=CC=C1
PINAL	Pinonaldehyde and similar APIN-derived aldehydes	G	168.0	L	Pinonaldehyde	O=CCC1CC(C(=O)C)C1(C)C
PINALP	Peroxy radicals from PINAL oxidation	G	199.0	L	[3-acetyl-2,2-dimethyl-1-(2-oxoethyl)cyclobutyl]peroxy	O=CCC1(O[O])CC(C(=O)C)C1(C)C
PPN	Peroxypropionyl nitrate	G	135.0	E	Peroxypopionyl nitrate	CCC(=O)OO[N+](=O)[O-]
PROG	Propylene glyocol and other 3 carbon dialcohols	G	76.1	E	1,2-Propylene glycol	CC(O)CO
RCO3	Higher saturated acyl peroxy radicals	G	89.0	L	Propanoylperoxy	CCC(=O)O[O]
ROCIOXY	Intermediate volatility oxygenated ROC species (directly emitted)	G	247.0	L	Decamethylcyclopentasiloxane	C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1
ROCN1ALK	Alkane-like ROC species with C* of 10-1 μg m-3	GP	408.8	L	5,9-Dimethylheptacosane	CCCCCCCCCCCCCCCCCCC(C)CCCC(C)CCCC
ROCN1OXY1	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.1	GP	312.5	L	Arachidic Acid	CCCCCCCCCCCCCCCCCCCC(=O)O
ROCN1OXY3	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.3	GP	230.3	L	DODECANEDIOIC ACID	C(CCCCCC(=O)O)CCCCC(=O)O
ROCN1OXY6	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.6	GP	190.2	L	2-hydroxy-octanedioic acid	C(CCC(C(=O)O)O)CCC(=O)O
ROCN2ALK	Alkane-like ROC species with C* of 10-2 μg m-3	GP	422.83	L	Triacontane	CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC
ROCN2OXY2	Oxygenated ROC species with C* of 10-1 μg m-3 and O:C of 0.2	GP	282.4	L	12(S)-hydroxy-16-Heptadecynoic Acid	C#CCCC[C@H](CCCCCCCCCCC(=O)O)O
ROCN2OXY4	Oxygenated ROC species with C* of 10-2 μg m-3 and O:C of 0.4	GP	232.3	L	2-HYDROXYUNDECANEDIOIC ACID	C(CCCCC(=O)O)CCCC(C(=O)O)O
ROCN2OXY8	Oxygenated ROC species with C* of 10-2 μg m-3 and O:C of 0.8	GP	194.2	L	3,4,5,6,7-Pentahydroxyheptan-2-one	CC(=O)C(C(C(C(CO)O)O)O)O
ROCP0ALK	Alkane-like ROC species with C* of 1 μg m-3	GP	394.77	L	11-Methylheptacosane	CCCCCCCCCCCCCCCCC(C)CCCCCCCCCC
ROCP0OXY2	Oxygenated ROC species with C* of 1 μg m-3 and O:C of 0.2	GP	242.4	L	3-oxotetradecanoic acid	CCCCCCCCCCCC(=O)CC(=O)O
ROCP0OXY4	Oxygenated ROC species with C* of 1 μg m-3 and O:C of 0.4	GP	202.3	L	DECANEDIOIC ACID	C(CCCCC(=O)O)CCCC(=O)O
ROCP1ALK	Alkane-like ROC species with C* of 10 μg m-3	GP	380.75	L	Heptacosane	CCCCCCCCCCCCCCCCCCCCCCCCCCC
ROCP1ALKP	Peroxy radicals from ROCP1ALK oxidation	G	411.74	L	heptacosan-3-ylperoxy	CCCCCCCCCCCCCCCCCCCCCCCCC(CC)O[O]
ROCP1ALKP2	Hydroxy peroxy radicals from ROCP1ALK alkoxy product	G	427.73	L	(3-hydroxyheptacosan-6-yl)peroxy	CCCCCCCCCCCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP1OXY1	Oxygenated ROC species with C* of 10 μg m-3 and O:C of 0.1	GP	270.5	L	HEPTADECANOIC ACID	CCCCCCCCCCCCCCCCC(=O)O
ROCP1OXY3	Oxygenated ROC species with C* of 10 μg m-3 and O:C of 0.3	GP	202.3	L	11-hydroxyundecanoic acid	C(CCCCCO)CCCCC(=O)O
ROCP2ALK	Alkane-like ROC species with C* of 10+2 μg m-3	GP	338.66	L	Tetracosane	CCCCCCCCCCCCCCCCCCCCCCCC
ROCP2ALKP	Peroxy radicals from ROCP2ALK oxidation	G	369.65	L	tetracosan-3-ylperoxy	CCCCCCCCCCCCCCCCCCCCCC(CC)O[O]
ROCP2ALKP2	Hydroxy peroxy radicals from ROCP2ALK alkoxy product	G	385.65	L	(3-hydroxytetracosan-6-yl)peroxy	CCCCCCCCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP2OXY2	Oxygenated ROC species with C* of 10+2 μg m-3 and O:C of 0.2	GP	200.3	L	Dodecanoic Acid	CCCCCCCCCCCC(=O)O
ROCP3ALK	Alkane-like ROC species with C* of 10+3 μg m-3	GP	296.58	L	Heneicosane	CCCCCCCCCCCCCCCCCCCCC
ROCP3ALKP	Peroxy radicals from ROCP3ALK oxidation	G	327.57	L	henicosan-3-ylperoxy	CCCCCCCCCCCCCCCCCCC(CC)O[O]
ROCP3ALKP2	Hydroxy peroxy radicals from ROCP3ALK alkoxy product	G	343.57	L	(3-hydroxyhenicosan-6-yl)peroxy	CCCCCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP3OXY2	Oxygenated ROC species with C* of 10+3 μg m-3 and O:C of 0.2	GP	186.3	L	11-hydroxyundecanal	C(CCCCCO)CCCCC=O
ROCP4ALK	Alkane-like ROC species with C* of 10+4 μg m-3	G	254.5	L	Octadecane	CCCCCCCCCCCCCCCCCC
ROCP4ALKP	Peroxy radicals from ROCP4ALK oxidation	G	285.49	L	octadecan-3-ylperoxy	CCCCCCCCCCCCCCCC(CC)O[O]
ROCP4ALKP2	Hydroxy peroxy radicals from ROCP4ALK alkoxy product	G	301.49	L	(3-hydroxyoctadecan-6-yl)peroxy	CCCCCCCCCCCCC(O[O])CCC(O)CC
ROCP4OXY2	Oxygenated ROC species with C* of 10+4 μg m-3 and O:C of 0.2	G	158.2	L	2-Ethylheptanoic Acid	CCCCCC(CC)C(=O)O
ROCP5ALK	Alkane-like ROC species with C* of 10+5 μg m-3	G	198.39	L	Tetradecane	CCCCCCCCCCCCCC
ROCP5ALKP	Peroxy radicals from ROCP5ALK oxidation	G	229.38	L	tetradecan-3-ylperoxy	CCCCCCCCCCCC(CC)O[O]
ROCP5ALKP2	Hydroxy peroxy radicals from ROCP5ALK alkoxy product	G	245.38	L	(3-hydroxytetradecan-6-yl)peroxy	CCCCCCCCC(O[O])CCC(O)CC
ROCP5ARO	Aromatic ROC species with C* of 10+5 μg m-3	G	190.33	L	Benzene, octyl-	CCCCCCCCC1=CC=CC=C1
ROCP5AROP	Peroxy radicals from ROCP5ARO oxidation	G	271.33	L	{8-hydroxy-5-octyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	CCCCCCCCC1(OO2)C=CC(O[O])C2C1O
ROCP5OXY1	Oxygenated ROC species with C* of 10+5 μg m-3 and O:C of 0.1	G	170.3	L	Undecanal	CCCCCCCCCCC=O
ROCP6ALK	Alkane-like ROC species with C* of 10+6 μg m-3	G	184.37	L	Tridecane	CCCCCCCCCCCCC
ROCP6ALKP	Peroxy radicals from ROCP6ALK oxidation	G	215.36	L	tridecan-3-ylperoxy	CCCCCCCCCCC(CC)O[O]
ROCP6ALKP2	Hydroxy peroxy radicals from ROCP6ALK alkoxy product	G	231.36	L	(3-hydroxytridecan-6-yl)peroxy	CCCCCCCC(O[O])CCC(O)CC
ROCP6ARO	Aromatic ROC species with C* of 10+6 μg m-3	G	176.3	L	1-Hexyl-4-methylbenzene	CCCCCCC1=CC=C(C)C=C1
ROCP6AROP	Peroxy radicals from ROCP6ARO oxidation	G	257.3	L	{2-hexyl-8-hydroxy-5-methyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	OC1C2C(CCCCCC)(O[O])C=CC1(C)OO2
ROCP6OXY1	Oxygenated ROC species with C* of 10+6 μg m-3 and O:C of 0.1	G	142.2	L	Nonanal	CCCCCCCCC=O
ROH	C3 and higher alcohols	G	60.0	L	Propanol	CCCO
SESQ	Sesquiterpenes	G	204.4	L	b-caryophyllene	C/C1=C/CCC(=C)C2CC(C)(C)C2CC\1
SESQNRO2	Peroxy radicals from SESQ reaction with nitrate radicals	G	298.4	L	[4,11,11-trimethyl-8-methylidene-5-(nitrooxy)bicyclo[7.2.0]undecan-4-yl]peroxy	[O]OC1(C)CCC2C(CC2(C)C)C(=C)CCC1O[N+](=O)[O-]
SESQRO2	Peroxy radicals from SESQ reaction with OH	G	253.4	L	{5-hydroxy-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undecan-4-yl}peroxy	[O]OC1(C)CCC2C(CC2(C)C)C(=C)CCC1O
SLOWROC	Slowly reacting ROC with kOH< 3.5x10-13 cm3 s-1	G	75.4	L	Hydrogen cyanide	C#N
SO2	Sulfur dioxide	G	64.0	E	Sulfur dioxide	O=S=O
SRF	Surface area of particles	P	1.0	L	Surface area of particles
SULF	Sulfuric acid	G	98.0	E	Sulfuric acid	OS(=O)(=O)O
SULRXN	Precursor of Aerosol Sulfate (tracking species)	G	98.0		NA
TOL	Toluene	G	92.14	E	Toluene	CC1=CC=CC=C1
TOLP	Peroxy radicals formed from TOL	G	173.14	L	{8-hydroxy-5-methyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2(C)OOC1C2O
TRPN	Terpene nitrates	G	215.0	L	3-hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-2-yl nitrate	O=N(=O)OC1(C)C(O)CC2CC1C2(C)C
UALD	Unsaturated aldehydes	G	84.1	L	2-Methylbut-2-enal	CC=C(C)C=O
UALP	Peroxy radicals formed from UALD	G	133.0	L	(3-hydroxy-3-methyl-4-oxobutan-2-yl)peroxy	CC(O[O])C(C)(O)C=O
XO2	Accounts for addition NO to NO2 conversions (tracking species)	G	1.0		NA
XYE	O- and p-xylene and other less reactive volatile aromatics with kOH < 1.46x10-11 cm3 s-1	G	106.2	L	Ethylbenzene	CCC1=CC=CC=C1
XYEP	Peroxy radicals formed from XYE	G	187.17	L	{5-ethyl-8-hydroxy-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2(CC)OOC1C2O
XYM	M-xylene and other more reactive volatile aromatics with kOH > 1.46x10-11 cm3 s-1	G	106.2	L	m-Xylene	CC1=CC(C)=CC=C1
XYMP	Peroxy radicals formed from XYM	G	187.17	L	{8-hydroxy-1,5-dimethyl-6,7-dioxabicyclo[3.2.1]oct-3-en-2-yl}peroxy	[O]OC1C=CC2(C)OOC1(C)C2O